
Catalog Number	AR005B78
Chemical Name	Tributyl Prop-1-Ene-1,2,3-Tricarboxylate
CAS Number	7568-58-3
Molecular Formula	C18H30O6
Molecular Weight	342.4272
MDL Number	MFCD07780359
SMILES	CCCCOC(=O)CC(=CC(=O)OCCCC)C(=O)OCCCC

Tributyl prop-1-ene-1,2,3-tricarboxylate is a versatile compound widely utilized in chemical synthesis, specifically in the field of organic chemistry. Its unique structure and reactivity make it a valuable intermediate for the creation of various functionalized molecules and complex organic compounds. In chemical synthesis, Tributyl prop-1-ene-1,2,3-tricarboxylate serves as a key building block in the construction of multi-step synthetic pathways, allowing chemists to introduce specific functional groups and tailor the structure of the final product with precision. By incorporating this compound into a synthesis strategy, researchers can access a diverse range of molecular architectures and achieve desired chemical transformations to develop new materials, pharmaceuticals, and specialty chemicals.