
Catalog Number	AR00G3Z5
Chemical Name	Chaetochromin A
CAS Number	75514-37-3
Molecular Formula	C30H26O10
Molecular Weight	546.5214
MDL Number	MFCD01740315
SMILES	C[C@H]1Oc2cc3c(c(c2C(=O)[C@@H]1C)O)c(O)cc(c3c1c(O)cc(c2c1cc1O[C@H](C)[C@H](C(=O)c1c2O)C)O)O

The compound (2R,2′R,3R,3′R,9S)-2,2′,3,3′-Tetrahydro-5,5′,6,6′,8,8′-hexahydroxy-2,2′,3,3′-tetramethyl[9,9′-bi-4H-naphtho[2,3-b]pyran]-4,4′-dione is commonly used in chemical synthesis as a chiral building block. Its unique structure and stereochemistry make it a valuable reagent in the preparation of complex organic molecules. Due to its multiple hydroxy groups and rigid backbone, this compound can serve as a key intermediate in the construction of biologically active compounds, natural products, and pharmaceuticals. Its chirality and functional groups allow for specific interactions and selective transformations, making it a versatile tool in the hands of synthetic chemists.