
Catalog Number	AR005SB5
Chemical Name	1H-Isoindole-1,3(2H)-dione,2-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-
CAS Number	75001-08-0
Molecular Formula	C14H17NO5
Molecular Weight	279.2885
MDL Number	MFCD07357494
SMILES	OCCOCCOCCN1C(=O)c2c(C1=O)cccc2

The compound 1H-Isoindole-1,3(2H)-dione, 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]- serves as a valuable reagent in chemical synthesis, specifically in the field of organic chemistry. It plays a crucial role in the synthesis of novel organic molecules with diverse applications. This compound is particularly useful for introducing functional groups, such as hydroxyl and ethoxy moieties, into complex molecular structures. Its ability to facilitate multistep reactions and modify molecular architectures makes it an essential building block in the creation of various organic compounds with tailored properties. By incorporating 1H-Isoindole-1,3(2H)-dione, 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]- into synthetic pathways, chemists can access a wide range of structurally diverse compounds for pharmaceuticals, materials science, and other chemical industries.