
Catalog Number	AR01CTKL
Chemical Name	21H,23H-Porphine, 5,10,15,20-tetrakis(3,4,5-trimethoxyphenyl)-
CAS Number	74684-35-8
Molecular Formula	C56H54N4O12
Molecular Weight	975.0476
MDL Number	MFCD00830315
SMILES	COc1cc(cc(c1OC)OC)/C/1=C/2C=CC(=N2)/C(=c2/cc/c(=C(/C3=N/C(=C(c4[nH]c1cc4)/c1cc(OC)c(c(c1)OC)OC)/C=C3)c1cc(OC)c(c(c1)OC)OC)/[nH]2)/c1cc(OC)c(c(c1)OC)OC

Meso-tetrakis(3,4,5-trimethoxyphenyl)porphyrin, also known as MTTMP, is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it an excellent catalyst in various reactions, particularly in organic synthesis.In chemical synthesis, MTTMP can be employed as a catalyst in the oxidation of organic substrates, such as alkenes and alkanes, to produce valuable products. Its porphyrin core allows for efficient electron transfer processes, making it a potent catalyst for oxidation reactions. Additionally, MTTMP has been used in the synthesis of heterocyclic compounds and as a key component in the preparation of functional materials.Furthermore, MTTMP demonstrates excellent stability and reusability as a catalyst, making it a cost-effective option for chemical transformations. Its ability to selectively promote specific reactions and facilitate the formation of desired products showcase its potential as a valuable tool in chemical synthesis applications.Overall, meso-tetrakis(3,4,5-trimethoxyphenyl)porphyrin plays a crucial role in advancing chemical synthesis processes, offering a reliable and efficient catalyst for a wide range of applications in the field.