
Catalog Number	AR005WTR
Chemical Name	Benzeneacetaldehyde, a-oxo-2-(trifluoromethyl)-,hydrate (1:1)
CAS Number	745783-91-9
Molecular Formula	C9H7F3O3
Molecular Weight	220.1453
MDL Number	MFCD06801323
SMILES	O=CC(=O)c1ccccc1C(F)(F)F.O

The 2-Oxo-2-(2-(trifluoromethyl)phenyl)acetaldehyde hydrate is a versatile compound commonly used in chemical synthesis. Its unique structure featuring a trifluoromethyl group allows it to serve as a valuable building block in the creation of various complex organic molecules. This compound is frequently employed in the pharmaceutical industry for the development of new drug candidates due to its ability to introduce specific functional groups into target molecules. In addition, it is utilized in the field of materials science for the synthesis of advanced materials with tailored properties. The 2-Oxo-2-(2-(trifluoromethyl)phenyl)acetaldehyde hydrate plays a crucial role in the creation of diverse chemical structures, making it an indispensable tool for synthetic chemists working in a range of industries.