
Catalog Number	AR00395C
Chemical Name	1,3-PROPANEDIOL, 2-AMINO-2-[2-(4-HEPTYLPHENYL)ETHYL]-
CAS Number	745767-97-9
Molecular Formula	C18H31NO2
Molecular Weight	293.44424000000004
MDL Number	MFCD28969063
SMILES	CCCCCCCc1ccc(cc1)CCC(CO)(CO)N

1,3-Propanediol, 2-amino-2-[2-(4-heptylphenyl)ethyl]- is a versatile compound widely used in chemical synthesis. Due to its unique chemical structure, this compound is particularly valuable in organic chemistry as a building block for the synthesis of complex molecules. Its primary application lies in the creation of novel pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, 1,3-Propanediol, 2-amino-2-[2-(4-heptylphenyl)ethyl]- serves as a key intermediate for the modification of functional groups and the formation of heterocycles. Its amino and alkyl side chains offer multiple points for derivatization, allowing chemists to tailor the compound for specific reactions. This compound is also used in the development of advanced materials, such as polymers and resins, where its structure plays a crucial role in determining the properties and performance of the final product.