
Catalog Number	AR005KDG
Chemical Name	Ethanediamide,N1-[(2-methoxy-4-methylphenyl)methyl]-N2-[2-(5-methyl-2-pyridinyl)ethyl]-
CAS Number	745047-94-3
Molecular Formula	C19H23N3O3
Molecular Weight	341.4042
MDL Number	MFCD28405002
SMILES	COc1cc(C)ccc1CNC(=O)C(=O)NCCc1ccc(cn1)C

N1-[(2-Methoxy-4-methylphenyl)methyl]-N2-[2-(5-methyl-2-pyridinyl)ethyl]ethanediamide, a versatile compound, plays a crucial role in organic chemical synthesis. This compound serves as a powerful building block for the creation of complex organic molecules due to its unique chemical structure and reactivity. When used in chemical synthesis, N1-[(2-Methoxy-4-methylphenyl)methyl]-N2-[2-(5-methyl-2-pyridinyl)ethyl]ethanediamide acts as a key intermediate in the formation of various pharmaceuticals, agrochemicals, and materials. Its functional groups enable selective modifications and transformations, allowing chemists to efficiently construct intricate molecular architectures. This compound's utility in chemical synthesis lies in its ability to facilitate the assembly of diverse organic compounds with high precision and control, making it an essential tool for synthetic chemists in the field.