
Catalog Number	AR008QVF
Chemical Name	7-Bromo-2-chloroquinazolin-4(3H)-one
CAS Number	744229-27-4
Molecular Formula	C8H4BrClN2O
Molecular Weight	259.4872
MDL Number	MFCD11520687
SMILES	Brc1ccc2c(c1)nc([nH]c2=O)Cl

7-Bromo-2-chloroquinazolin-4(3H)-one is a versatile chemical compound commonly used in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block in the preparation of various pharmaceuticals, agrochemicals, and materials.In organic synthesis, 7-Bromo-2-chloroquinazolin-4(3H)-one can be utilized as a key intermediate for the synthesis of heterocyclic compounds and complex organic molecules. Its strategic position in the synthesis pathway allows for the introduction of functional groups and stereochemistry control, making it a valuable tool for medicinal chemists and researchers.Furthermore, the presence of both bromine and chlorine atoms in its structure imparts distinctive reactivity, allowing for selective transformations and diverse chemical modifications. This enables chemists to access a wide range of derivatives with tailored properties, enhancing the potential applications of the final products.Overall, 7-Bromo-2-chloroquinazolin-4(3H)-one plays a crucial role in the field of chemical synthesis, offering a valuable platform for the development of novel compounds with potential applications in various industries.