
Catalog Number	AR00FD49
Chemical Name	N-METHYL-4-(P-FORMYLSTYRYL)PYRIDINIUM METHYLSULFATE
CAS Number	74401-04-0
Molecular Formula	C16H17NO5S
Molecular Weight	335.3749
MDL Number	MFCD04038138
SMILES	COS(=O)(=O)[O-].O=Cc1ccc(cc1)/C=C/c1cc[n+](cc1)C

Pyridinium, 4-[2-(4-formylphenyl)ethenyl]-1-methyl-, methyl sulfate (1:1) is a versatile chemical compound predominantly used in chemical synthesis as a key intermediate for the production of various organic molecules. This compound serves as a valuable reagent in a wide range of synthetic processes due to its unique structural properties and reactivity. In chemical synthesis, it plays a crucial role in the formation of complex organic molecules through various reactions such as condensation, alkylation, and oxidation. Moreover, its distinctive chemical structure allows for the introduction of functional groups and modification of organic compounds, making it indispensable in the development of novel materials and pharmaceuticals.