
Catalog Number	AR005ZEA
Chemical Name	Guanosine, 4'-thio-
CAS Number	74249-68-6
Molecular Formula	C10H13N5O4S
Molecular Weight	299.3063
MDL Number	MFCD28343636
SMILES	OC[C@H]1S[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(N)[nH]c2=O

Guanosine, 4'-thio-, also known as 4-thio-dG, is a modified nucleoside that plays a crucial role in chemical synthesis. This compound is widely utilized as a building block in the synthesis of oligonucleotides, which are short chains of nucleotides that are essential in various biotechnological applications.In chemical synthesis, Guanosine, 4'-thio-, serves as a versatile precursor for the introduction of sulfur-containing functionalities into nucleic acid sequences. By incorporating this modified nucleoside into oligonucleotides, researchers can introduce structural diversity and impart unique chemical properties to the resulting molecules. Furthermore, the sulfur atom in Guanosine, 4'-thio-, offers opportunities for specific interactions with other molecules, enabling the design and construction of novel nucleic acid structures with enhanced functionalities.Overall, Guanosine, 4'-thio-, is a valuable tool in chemical synthesis, providing researchers with the means to tailor nucleic acid sequences for a wide range of applications, including drug development, gene therapy, and molecular diagnostics.