
Catalog Number	AR00FXCG
Chemical Name	1H-INDAZOLE, 3-BROMO-1-METHYL-7-NITRO-
CAS Number	74209-37-3
Molecular Formula	C8H6BrN3O2
Molecular Weight	256.0561
MDL Number	MFCD11977534
SMILES	[O-][N+](=O)c1cccc2c1n(C)nc2Br

3-Bromo-1-methyl-7-nitro-1H-indazole serves as a versatile intermediate in chemical synthesis, particularly in the pharmaceutical industry. This compound plays a crucial role in the development of various pharmaceutical agents due to its unique structural properties. It is commonly used as a building block for the synthesis of complex molecules, allowing for the creation of novel drug candidates and other bioactive compounds. Additionally, its specific chemical reactivity enables the introduction of functional groups at strategic positions during the synthesis process, facilitating the creation of diverse molecular structures with specific biological activities. Overall, the application of 3-Bromo-1-methyl-7-nitro-1H-indazole in chemical synthesis demonstrates its importance in the production of valuable compounds with potential therapeutic benefits.