
Catalog Number	AR00FBZG
Chemical Name	Gloriosine
CAS Number	7411-12-3
Molecular Formula	C21H23NO6
Molecular Weight	385.41042
MDL Number	MFCD00468038
SMILES	O=CN[C@H]1CCc2c(-c3c1cc(=O)c(cc3)OC)c(OC)c(c(c2)OC)OC

N-Deacetyl-N-formylcolchicine is a valuable intermediate used in organic chemical synthesis due to its versatile reactivity and functional group compatibility. Its application in synthetic chemistry extends to the formation of various complex structures and the development of novel molecules for pharmaceutical and agrochemical industries. This compound serves as a key building block in the synthesis of bioactive compounds, alkaloids, and heterocyclic molecules, showcasing its importance in drug discovery and development efforts. Additionally, N-Deacetyl-N-formylcolchicine plays a crucial role in the creation of diverse chemical libraries for screening purposes, further highlighting its significance in research and development of new chemical entities.