
Catalog Number	AR00FH8N
Chemical Name	N-[3-[4-[4-[(Cyclohexylmethylsulfonyl)amino]butyl]piperazin-1-yl]phenyl]acetamide
CAS Number	740873-06-7
Molecular Formula	C23H38N4O3S
Molecular Weight	450.6378199999999
MDL Number	MFCD09833676
SMILES	CC(=O)Nc1cccc(c1)N1CCN(CC1)CCCCNS(=O)(=O)CC1CCCCC1

The compound N-[3-[4-[4-[[(Cyclohexylmethyl)sulfonyl]amino]butyl]-1-piperazinyl]phenyl]acetamide is a valuable reagent in chemical synthesis due to its versatile applications. In organic chemistry, it is commonly employed as a building block in the synthesis of various biologically active molecules. By serving as a key intermediate, this compound enables the construction of complex structures with specific functionalities. Its unique molecular structure allows for precise modifications to be made, leading to the creation of novel compounds with potential pharmaceutical or industrial significance. Furthermore, the presence of functional groups in the molecule offers opportunities for further derivatization, expanding its utility in diverse synthetic pathways.