
Catalog Number	AR005BAQ
Chemical Name	Phosphonium,triphenyl(2-pyridinylmethyl)-, bromide (1:1)
CAS Number	73870-22-1
Molecular Formula	C24H21BrNP
Molecular Weight	434.30800100000005
MDL Number	MFCD03411777
SMILES	c1ccc(nc1)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]

Phosphonium, triphenyl(2-pyridinylmethyl)-, bromide (1:1) is a versatile chemical compound commonly used in chemical synthesis. It serves as an efficient reagent in various organic reactions, particularly in the formation of carbon-carbon and carbon-nitrogen bonds. This compound is widely employed in the synthesis of complex organic molecules, including pharmaceuticals, agrochemicals, and materials science. Its unique structure and properties make it a valuable tool for chemists seeking to design and construct intricate molecular architectures with precision and efficiency.