
Catalog Number	AR008QYW
Chemical Name	Butanoic acid, 4-(3-formylphenoxy)-, ethyl ester
CAS Number	73718-01-1
Molecular Formula	C13H16O4
Molecular Weight	236.2637
MDL Number	MFCD18375400
SMILES	CCOC(=O)CCCOc1cccc(c1)C=O

Butanoic acid, 4-(3-formylphenoxy)-, ethyl ester possesses significant utility in chemical synthesis, particularly in the realm of organic chemistry. Its versatile nature allows for a wide array of applications in various synthetic processes. This compound serves as a valuable building block for the creation of complex molecules due to its unique structural characteristics. Its inclusion in chemical reactions contributes to the formation of diverse compounds with distinct properties. Overall, the utilization of Butanoic acid, 4-(3-formylphenoxy)-, ethyl ester in chemical synthesis enables the generation of novel substances and plays a crucial role in advancing the field of organic chemistry.