
Catalog Number	AR00FG2H
Chemical Name	3-Hydroxy-5-nitrophenylboronic acid
CAS Number	737001-07-9
Molecular Formula	C6H6BNO5
Molecular Weight	182.9265
MDL Number	MFCD05664060
SMILES	Oc1cc(cc(c1)[N+](=O)[O-])B(O)O

3-Hydroxy-5-nitrophenylboronic acid is a versatile compound widely utilized in chemical synthesis due to its unique properties and reactivity. In organic chemistry, this compound serves as a key building block for the preparation of various advanced materials and pharmaceutical agents. One of its primary applications lies in its use as a valuable intermediate in the synthesis of biologically active molecules, such as potential drug candidates and agrochemicals.Furthermore, 3-Hydroxy-5-nitrophenylboronic acid exhibits exceptional affinity for forming covalent bonds with certain functional groups, making it a valuable tool in cross-coupling reactions in organic synthesis. Its boronic acid moiety enables it to participate in Suzuki-Miyaura coupling reactions, enabling the formation of complex molecular structures with high efficiency and specificity. This compound also finds utility in the preparation of fluorescent dyes and catalytic systems due to its electron-rich nature and ability to facilitate important chemical transformations.Overall, the diverse applications of 3-Hydroxy-5-nitrophenylboronic acid in chemical synthesis highlight its significance as a crucial reagent for the development of novel compounds with potential pharmaceutical, material science, and agrochemical applications.