
Catalog Number	AR00J3CK
Chemical Name	2-chloro-7-(methylthio)-3-quinolinecarbaldehyde
CAS Number	73568-30-6
Molecular Formula	C11H8ClNOS
Molecular Weight	237.7053
MDL Number	MFCD02049247
SMILES	CSc1ccc2c(c1)nc(c(c2)C=O)Cl

2-Chloro-7-(methylthio)quinoline-3-carbaldehyde, a versatile building block in chemical synthesis, is commonly employed in the production of various pharmaceuticals and agrochemicals. Its unique molecular structure and reactivity make it a valuable intermediate in the creation of complex organic compounds, particularly those with quinoline and aldehyde functionalities. This compound serves as a key component in the synthesis of diverse bioactive molecules, such as antimalarial and antibacterial agents, due to its ability to participate in a wide range of chemical transformations, including condensation, oxidation, and reduction reactions. Additionally, its presence in the synthesis of heterocyclic compounds enhances the diversity and potency of the final products, making it a crucial tool for medicinal and agricultural chemistry research.