
Catalog Number	AR008REM
Chemical Name	9,10-Anthracenedicarboxylic acid, dimethyl ester
CAS Number	73016-10-1
Molecular Formula	C18H14O4
Molecular Weight	294.3014
MDL Number	MFCD06203816
SMILES	COC(=O)c1c2ccccc2c(c2c1cccc2)C(=O)OC

9,10-Anthracenedicarboxylic acid, dimethyl ester is a versatile compound widely used in chemical synthesis as a key building block in the production of various organic compounds. This compound serves as an important intermediate for the synthesis of dyes, pharmaceuticals, and materials with luminescent properties. Its unique structure and reactivity make it a valuable tool in the creation of complex organic molecules through various chemical reactions, such as esterification, hydrolysis, and coupling reactions. Additionally, its aromatic backbone allows for the formation of π-conjugated systems, making it a valuable component in the design and synthesis of organic electronic materials. Overall, 9,10-Anthracenedicarboxylic acid, dimethyl ester plays a crucial role in modern chemical synthesis strategies, enabling the construction of diverse and functional organic molecules for various applications.