
Catalog Number	AR005G6J
Chemical Name	(4-hydroxy-8a-methoxy-5-methyl-6,7-dioxo-1,1a,2,6,7,8,8a,8b-octahydroazireno[2',3':3,4]pyrrolo[1,2-a]indol-8-yl)methyl carbamate
CAS Number	72741-86-7
Molecular Formula	C15H17N3O6
Molecular Weight	335.312
SMILES	COC12C3NC3CN2C2=C(C1COC(=O)N)C(=O)C(=O)C(=C2O)C
NSC Number	123105

The compound (4-hydroxy-8a-methoxy-5-methyl-6,7-dioxo-1,1a,2,6,7,8,8a,8b-octahydroazireno[2',3':3,4]pyrrolo[1,2-a]indol-8-yl)methyl carbamate plays a crucial role in chemical synthesis as a versatile building block. Its unique structure and reactivity make it a valuable intermediate in the synthesis of complex organic molecules. This compound can be used for the functionalization of various molecules through its reactive carbamate group, allowing for the introduction of other functional groups or modifying existing ones. Additionally, its octahydroazirenoindole core provides a scaffold for further derivatization, making it a valuable tool for the creation of novel chemical entities in drug discovery and material science.