
Catalog Number	AR0066IA
Chemical Name	Ethyl 4-bromo-6-methoxy-1，5-naphthyridine-3-carboxylate
CAS Number	724788-64-1
Molecular Formula	C12H11BrN2O3
Molecular Weight	311.13134
MDL Number	MFCD20921954
SMILES	CCOC(=O)c1cnc2c(c1Br)nc(cc2)OC

Ethyl 4-bromo-6-methoxy-1,5-naphthyridine-3-carboxylate is a valuable compound utilized in chemical synthesis, particularly in the field of medicinal chemistry. This molecule serves as a versatile building block in the creation of various bioactive compounds and pharmaceutical agents. Its unique structure provides opportunities for selective functionalization, enabling the synthesis of diverse derivatives with specific pharmacological properties. By incorporating Ethyl 4-bromo-6-methoxy-1,5-naphthyridine-3-carboxylate into synthetic pathways, chemists can access novel compounds with potential applications in drug discovery and development.