
Catalog Number	AR00FI0J
Chemical Name	7-bromo-8-nitroquinoline
CAS Number	71331-02-7
Molecular Formula	C9H5ClN2O2
Molecular Weight	208.6012
MDL Number	MFCD00837755
SMILES	[O-][N+](=O)c1c(Cl)ccc2c1nccc2

7-Chloro-8-nitroquinoline is a versatile chemical compound that finds extensive applications in organic synthesis. One of its key uses is as a building block in the preparation of various pharmaceuticals and agrochemicals. Due to its unique structure and reactivity, this compound serves as a valuable intermediate in the synthesis of biologically active molecules.In chemical synthesis, 7-Chloro-8-nitroquinoline can undergo various functional group transformations, such as reduction, substitution, and coupling reactions. These transformations enable the modification of its structure to incorporate desirable functionalities for specific applications. Furthermore, the presence of the nitro and chloro substituents in the quinoline ring imparts distinct chemical properties to the compound, making it a useful starting material for the generation of diverse chemical derivatives.Additionally, 7-Chloro-8-nitroquinoline can participate in heterocyclic chemistry, serving as a precursor for the construction of heterocyclic frameworks commonly found in pharmaceutical compounds. Through strategic synthetic manipulations, this compound can be tailored to introduce specific pharmacophores or structural motifs necessary for enhancing the biological activity of the target molecules.Overall, the strategic utilization of 7-Chloro-8-nitroquinoline in chemical synthesis enables the efficient assembly of complex organic molecules with therapeutic or agricultural relevance, highlighting its importance as a valuable tool in the realm of modern synthetic chemistry.