
Catalog Number	AR00FC2Y
Chemical Name	ISOPROPAMIDE IODIDE
CAS Number	71-81-8
Molecular Formula	C23H34IN2O
Molecular Weight	481.4333
MDL Number	MFCD00063513
SMILES	CC([N](C(C)C)(CCC(c1ccccc1)(c1ccccc1)C(=O)N)C)C.I
NSC Number	757066

Isopropamide iodide is a vital reagent in chemical synthesis, particularly in the field of organic chemistry. It serves as a potent quaternary ammonium salt reagent that is utilized for the selective methylation of various nucleophiles. This reaction occurs through an SN2 substitution mechanism, where the iodide ion acts as a leaving group. Isopropamide iodide is particularly valuable in the synthesis of pharmaceutical compounds and complex organic molecules due to its ability to introduce the isopropyl group in a controlled and efficient manner. Additionally, it can be employed in the synthesis of building blocks for drug discovery and material science, making it a versatile tool for chemical researchers and synthetic chemists. Its high reactivity and selectivity make Isopropamide iodide a valuable asset in the arsenal of reagents used for organic synthesis.