
Catalog Number	AR0063ZS
Chemical Name	1H-Imidazolium,1,3-didecyl-2-methyl-, chloride (1:1)
CAS Number	70862-65-6
Molecular Formula	C24H47ClN2
Molecular Weight	399.0964
MDL Number	MFCD00216605
SMILES	CCCCCCCCCCn1cc[n+](c1C)CCCCCCCCCC.[Cl-]

1,3-Didecyl-2-methylimidazolium chloride is a versatile compound commonly used in chemical synthesis as a phase transfer catalyst. This specialized chemical plays a crucial role in facilitating the transfer of substances between different phases during organic reactions. Its unique structure allows it to efficiently transport reactants from one phase to another, which is essential in reactions where the reactants are insoluble in the same phase.In chemical synthesis, 1,3-Didecyl-2-methylimidazolium chloride is particularly valued for its ability to enhance reaction yields and selectivity. By serving as a catalyst, it promotes the formation of desired products while minimizing unwanted by-products. Its efficiency in phase transfer processes makes it a valuable tool in various organic transformations, including nucleophilic substitutions, alkylations, and oxidations.Furthermore, 1,3-Didecyl-2-methylimidazolium chloride is known for its stability and reusability, making it a cost-effective option for industrial-scale chemical synthesis. Its compatibility with a wide range of substrates and reaction conditions further contributes to its widespread use in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals.