
Catalog Number	AR00ICSR
Chemical Name	Benzene, 1-fluoro-2-methoxy-5-methyl-3-nitro-
CAS Number	708-04-3
Molecular Formula	C8H8FNO3
Molecular Weight	185.1524
MDL Number	MFCD22053532
SMILES	COc1c(F)cc(cc1[N+](=O)[O-])C

1-Fluoro-2-methoxy-5-methyl-3-nitrobenzene, a versatile compound commonly utilized in chemical synthesis as a key building block. This compound is valued for its strategic incorporation of a nitro group, fluorine atom, and methyl and methoxy substituents, which provide a range of opportunities for functional group interconversions and selective transformations in organic synthesis. Its fluorine atom imparts unique reactivity and selectivity, enabling the introduction of fluorine-containing motifs into complex molecules, while the nitro group serves as a versatile precursor for various functionalizations. The methyl and methoxy groups offer steric and electronic properties that can be leveraged for enhancing selectivity and modulating the overall chemical reactivity of the molecule. When employed in chemical reactions, 1-Fluoro-2-methoxy-5-methyl-3-nitrobenzene facilitates the construction of diverse molecular architectures with tailored properties and functionalities, making it an indispensable tool in the synthesis of pharmaceuticals, agrochemicals, and materials with advanced properties. Its potential applications span from medicinal chemistry to materials science, demonstrating its significance as a valuable synthetic intermediate in modern organic synthesis.