
Catalog Number	AR005TJG
Chemical Name	3-CHLORO-L-TYROSINE
CAS Number	70680-93-2
Molecular Formula	C9H10ClNO3
Molecular Weight	215.6336
MDL Number	MFCD18661976
SMILES	OC(=O)[C@H](Cc1ccc(cc1Cl)O)N

The (S)-2-Amino-3-(2-chloro-4-hydroxyphenyl)propanoic acid, also known as $name$, is a crucial compound widely utilized in chemical synthesis processes. With its unique structure and properties, this compound serves as a valuable building block in the creation of pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, (S)-2-Amino-3-(2-chloro-4-hydroxyphenyl)propanoic acid plays a pivotal role as a chiral building block. Its chirality is essential in creating enantiopure compounds, which are crucial in the pharmaceutical industry for producing drugs with high efficacy and minimal side effects. By incorporating this compound into synthetic routes, chemists can efficiently access a range of biologically active molecules with precise stereochemistry.Furthermore, (S)-2-Amino-3-(2-chloro-4-hydroxyphenyl)propanoic acid can act as a key intermediate in the synthesis of complex molecules. Its functional groups enable versatile chemical transformations, allowing for the introduction of various substituents and structural modifications. This flexibility makes it a versatile starting material for the synthesis of diverse compounds, contributing to the development of novel chemical entities with potential applications in various fields.Overall, the application of (S)-2-Amino-3-(2-chloro-4-hydroxyphenyl)propanoic acid in chemical synthesis underscores its significance as a valuable component in the creation of intricate molecular structures with specific stereochemical properties. Its role in enabling the construction of complex molecules highlights its importance in advancing research and innovation within the realm of synthetic chemistry.