
Catalog Number	AR00FFE9
Chemical Name	DIHYDROTAMARIXETIN
CAS Number	70411-27-7
Molecular Formula	C16H14O7
Molecular Weight	318.2782
MDL Number	MFCD20274965
SMILES	COc1ccc(cc1O)[C@H]1Oc2cc(O)cc(c2C(=O)[C@@H]1O)O

4'-O-Methyltaxifolin is a versatile compound often utilized in chemical synthesis for its unique properties and reactivity. As a derivative of taxifolin, this molecule plays a crucial role in the development of various pharmaceuticals, agrochemicals, and materials. In chemical synthesis, 4'-O-Methyltaxifolin serves as a valuable building block for creating complex molecular structures due to its structural characteristics and functional groups. Its compatibility with different reaction conditions and ability to undergo selective chemical transformations make it an ideal candidate for the synthesis of novel compounds with potential biological activities and industrial applications. By incorporating 4'-O-Methyltaxifolin into synthetic pathways, chemists can access a broad range of structurally diverse molecules that have the potential to contribute significantly to the fields of chemistry, medicine, and materials science.