
Catalog Number	AR006AEW
Chemical Name	3-Iodo-5-nitro-1H-indazole
CAS Number	70315-69-4
Molecular Formula	C7H4IN3O2
Molecular Weight	289.0300
MDL Number	MFCD07781630
SMILES	[O-][N+](=O)c1cc2c(I)n[nH]c2cc1

3-Iodo-5-nitro-1H-indazole is a versatile compound commonly used in chemical synthesis processes. It serves as a key building block for the creation of various pharmaceuticals, agrochemicals, and functional materials. Its unique structure and reactivity make it valuable in the preparation of diverse organic compounds through various synthetic routes.One notable application of 3-Iodo-5-nitro-1H-indazole is its use as a precursor in the synthesis of bioactive molecules such as pharmaceutical intermediates and organic dyes. By introducing specific functional groups to the indazole core, chemists can modify its properties and tailor the final product for specific applications. This compound's ability to undergo various chemical transformations, including substitution reactions, allows for a wide range of synthetic possibilities.Additionally, 3-Iodo-5-nitro-1H-indazole is employed in the development of new materials with specific electronic or optical properties. Its presence in the molecular structure can influence the material's behavior and performance, making it a valuable tool in the design of advanced functional materials. Whether used in academia or industry, this compound plays a crucial role in advancing research and innovation in the field of organic chemistry.Overall, 3-Iodo-5-nitro-1H-indazole offers chemists a valuable starting point for the synthesis of complex organic molecules and functional materials, showcasing its importance in chemical synthesis applications.