
Catalog Number	AR00ICMY
Chemical Name	2-Bromo-5-methoxy-4-(trifluoromethyl)aniline
CAS Number	694514-19-7
Molecular Formula	C8H7BrF3NO
Molecular Weight	270.0464896
MDL Number	MFCD20484368
SMILES	COc1cc(N)c(cc1C(F)(F)F)Br

2-Bromo-5-methoxy-4-(trifluoromethyl)aniline, often referred to simply as $name$, is a versatile compound commonly utilized in chemical synthesis. This compound serves as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. 2-Bromo-5-methoxy-4-(trifluoromethyl)aniline is particularly useful in the synthesis of complex molecules due to its unique structure, which lends itself well to forming key bonds and functional groups. By incorporating this compound into synthetic routes, chemists can efficiently introduce the bromo, methoxy, and trifluoromethyl substituents into target molecules, thereby modulating their properties and enhancing their biological activities.In drug discovery and development, 2-Bromo-5-methoxy-4-(trifluoromethyl)aniline plays a crucial role in the construction of novel drug candidates with improved efficacy and selectivity. Furthermore, its presence in the synthesis of agrochemicals allows for the design of crop protection agents that exhibit enhanced performance and environmental safety.Overall, the strategic inclusion of 2-Bromo-5-methoxy-4-(trifluoromethyl)aniline in chemical synthesis processes enables the generation of structurally diverse compounds with tailored properties, making it a valuable tool for researchers and industries engaged in the creation of advanced materials and bioactive substances.