
Catalog Number	AR005MVI
Chemical Name	2-(2-Morpholinoethoxy)benzaldehyde oxalate
CAS Number	68997-45-5
Molecular Formula	C15H19NO7
Molecular Weight	325.3139
MDL Number	MFCD07440326
SMILES	OC(=O)C(=O)O.O=Cc1ccccc1OCCN1CCOCC1

2-(2-Morpholinoethoxy)benzaldehyde is a versatile compound widely used in chemical synthesis for its unique properties and diverse applications. This aldehyde derivative is commonly employed as a key building block in the synthesis of various organic compounds due to its functional groups and reactivity. In organic synthesis, 2-(2-Morpholinoethoxy)benzaldehyde serves as a valuable intermediate for the preparation of heterocyclic compounds, pharmaceuticals, and agricultural chemicals. Additionally, its aldehyde functionality allows for further derivatization to create more complex molecules, making it a valuable tool for synthetic chemists. The presence of the morpholine moiety provides a versatile nitrogen-containing group that can participate in a range of chemical reactions, expanding the compound's synthetic utility. Overall, the application of 2-(2-Morpholinoethoxy)benzaldehyde in chemical synthesis enables the efficient and selective construction of diverse organic molecules with potential applications in various fields of chemistry.