
Catalog Number	AR01KL0M
Chemical Name	3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoicacid
CAS Number	68755-36-2
Molecular Formula	C10H8BrF3O2
Molecular Weight	297.0685
MDL Number	MFCD18392386
SMILES	OC(=O)CCc1ccc(cc1Br)C(F)(F)F

3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoic acid is a versatile compound widely used in chemical synthesis due to its unique reactivity and functional groups. This compound serves as a valuable building block in organic chemistry, particularly in the synthesis of pharmaceuticals and agrochemicals.One of the key applications of 3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoic acid is its role as a precursor in the preparation of various biologically active compounds. By selectively modifying the functional groups present in this compound, chemists can synthesize a diverse range of pharmacologically relevant molecules with potential therapeutic benefits. Additionally, the presence of the trifluoromethyl group enhances the compound's lipophilicity and bioavailability, making it a valuable component in drug discovery research.Furthermore, 3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoic acid can also be utilized in the synthesis of specialty chemicals and materials. Its reactivity allows for the introduction of specific functional groups, enabling the creation of tailored compounds for various industrial applications such as polymer chemistry, materials science, and catalysis.Overall, the versatile nature of 3-(2-Bromo-4-(trifluoromethyl)phenyl)propanoic acid makes it a valuable tool in the hands of synthetic chemists, offering a wide range of possibilities for the design and preparation of novel compounds with diverse functionalities.