
Catalog Number	AR006J0X
Chemical Name	TRANS-2-(4-HYDROXYCYCLOHEXYL)ACETIC ACID
CAS Number	68592-23-4
Molecular Formula	C8H14O3
Molecular Weight	158.195
MDL Number	MFCD16661181
SMILES	O[C@@H]1CC[C@H](CC1)CC(=O)O

The trans-4-Hydroxycyclohexaneacetic acid is a versatile compound widely used in chemical synthesis due to its unique structural properties. This compound plays a crucial role as a building block in the synthesis of various pharmaceuticals, agrochemicals, and fine chemicals.In chemical synthesis, trans-4-Hydroxycyclohexaneacetic acid serves as a key intermediate in the production of some important compounds such as nonsteroidal anti-inflammatory drugs (NSAIDs), prostaglandins, and other bioactive molecules. Its hydroxyl group and cyclohexane ring structure make it a valuable starting material for the synthesis of drug candidates and other complex organic compounds.Due to its ability to participate in various chemical reactions, trans-4-Hydroxycyclohexaneacetic acid can be functionalized to introduce different functional groups or stereochemical elements into the final products. Its strategic placement within a molecular framework enables chemists to control the stereochemistry, reactivity, and overall properties of the synthesized compounds.Overall, trans-4-Hydroxycyclohexaneacetic acid serves as a key component in the design and synthesis of diverse chemical entities, making it a valuable tool in the field of organic chemistry and drug discovery.