
Catalog Number	AR01EXNH
Chemical Name	5-Chloro-2-methoxy-4-methyl-3-nitroacetophenone
CAS Number	685892-19-7
Molecular Formula	C10H10ClNO4
Molecular Weight	243.6437
MDL Number	MFCD03789145
SMILES	COc1c(cc(c(c1[N+](=O)[O-])C)Cl)C(=O)C

1-(5-CHLORO-2-METHOXY-4-METHYL-3-NITROPHENYL)-ETHANONE is a versatile compound commonly used in chemical synthesis due to its unique structural features and reactivity. This compound serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and organic compounds. Its nitro and chloro substituents make it a valuable building block for the synthesis of complex molecules with diverse biological activities. The presence of an ethanone functional group further enhances its potential for modification and derivatization, allowing chemists to tailor its properties for specific applications. Its role in chemical synthesis extends to the development of new materials, dyes, and fine chemicals, demonstrating its broad utility in the field of organic chemistry.