
Catalog Number	AR00FGUI
Chemical Name	1H-Pyrrolo[2,3-b]pyridin-5-ol, 1-[tris(1-methylethyl)silyl]-
CAS Number	685514-01-6
Molecular Formula	C16H26N2OSi
Molecular Weight	290.4759
MDL Number	MFCD11616408
SMILES	Oc1cnc2c(c1)ccn2[Si](C(C)C)(C(C)C)C(C)C

1-(Triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol is a versatile compound utilized in chemical synthesis as a key building block for the creation of novel organic molecules. Its unique structure and properties make it a valuable tool for the development of various pharmaceuticals, agrochemicals, and materials.In the realm of chemical synthesis, this compound serves as a crucial intermediate in the production of complex heterocyclic compounds. Its triisopropylsilyl protecting group provides stability and control over reactivity during multiple steps of synthesis, allowing for selective functional group manipulations. This feature is particularly beneficial in the construction of intricate molecular frameworks where precise modifications are necessary.Furthermore, 1-(Triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol has found applications in the synthesis of biologically active compounds due to its ability to introduce specific functionalities and structural motifs into target molecules. Its incorporation can lead to enhanced pharmacological properties or improved performance characteristics in various applications.Overall, the strategic use of 1-(Triisopropylsilyl)-1H-pyrrolo[2,3-b]pyridin-5-ol in chemical synthesis enables chemists to access a diverse array of complex molecules with tailored properties, making it a valuable asset in the field of organic chemistry.