
Catalog Number	AR003QEK
Chemical Name	Dimethoxydiphenylsilane
CAS Number	6843-66-9
Molecular Formula	C14H16O2Si
Molecular Weight	244.3611
MDL Number	MFCD00025690
SMILES	CO[Si](c1ccccc1)(c1ccccc1)OC

Dimethoxydiphenylsilane is a versatile compound widely used in chemical synthesis as a key building block for various reactions. Its primary application lies in its role as a silane coupling agent, functioning to promote adhesion between different materials. In organic synthesis, dimethoxydiphenylsilane serves as a useful reagent for the protection of hydroxy groups in alcohols, phenols, and carbohydrates. Additionally, it is an essential precursor in the preparation of silicon-containing polymers and silicon-based materials. Its unique chemical properties make it a valuable tool in creating novel organic compounds and functional materials.