
Catalog Number	AR006KJH
Chemical Name	4-Bromo-2-fluorophenyl cyclohexyl ketone
CAS Number	684271-18-9
Molecular Formula	C13H14BrFO
Molecular Weight	285.1521
MDL Number	MFCD03841368
SMILES	Brc1ccc(c(c1)F)C(=O)C1CCCCC1

The (4-Bromo-2-fluorophenyl)cyclohexylmethanone is a valuable chemical reagent commonly utilized in chemical synthesis processes. With its unique molecular structure, this compound serves as a versatile building block in the creation of various organic compounds. It can be employed in the synthesis of pharmaceutical intermediates, agrochemicals, and material science applications, showcasing its significance in the field of organic chemistry. Additionally, its selective reactivity allows for precise manipulation of the chemical structure, enabling chemists to access novel compounds for further research and development purposes. The (4-Bromo-2-fluorophenyl)cyclohexylmethanone serves as a valuable tool in the hands of synthetic chemists, facilitating the creation of complex molecules with tailored properties and functionalities.