
Catalog Number	AR01EXN2
Chemical Name	4-(2-Amino-4-thiazolyl)-3-(2,4-dichlorophenyl)-5-methylisoxazole
CAS Number	683274-66-0
Molecular Formula	C13H9Cl2N3OS
Molecular Weight	326.2011
MDL Number	MFCD03407479
SMILES	Clc1ccc(c(c1)Cl)c1noc(c1c1csc(n1)N)C

4-(2-Amino-4-thiazolyl)-3-(2,4-dichlorophenyl)-5-methylisoxazole is a versatile compound that finds significant application in chemical synthesis processes. This compound serves as a valuable building block in organic synthesis due to its unique structural features and reactivity. In particular, it is commonly utilized in the pharmaceutical industry for the development of new drug molecules. The presence of both thiazole and isoxazole rings in its structure enables it to participate in diverse chemical reactions, making it a valuable intermediate in the synthesis of various biologically active compounds. Additionally, the dichlorophenyl moiety provides opportunities for further functionalization, allowing for the creation of novel molecules with tailored properties. Overall, 4-(2-Amino-4-thiazolyl)-3-(2,4-dichlorophenyl)-5-methylisoxazole plays a crucial role in advancing the field of chemical synthesis and drug discovery.