
Catalog Number	AR005M61
Chemical Name	3-AMINO-3-(3,4-DIFLUORO-PHENYL)-PROPANOIC ACID
CAS Number	682804-05-3
Molecular Formula	C9H9F2NO2
Molecular Weight	201.1700664
MDL Number	MFCD03002489
SMILES	OC(=O)CC(c1ccc(c(c1)F)F)N

3-AMINO-3-(3,4-DIFLUORO-PHENYL)-PROPANOIC ACID, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a valuable building block in the creation of complex organic molecules, particularly in the pharmaceutical and agrochemical industries.One key application of this compound is in the synthesis of novel pharmaceutical agents. By incorporating 3-AMINO-3-(3,4-DIFLUORO-PHENYL)-PROPANOIC ACID into drug molecules, chemists can modulate the pharmacological properties of the resulting compounds, such as enhancing their potency or improving their metabolic stability. This compound can also act as a key intermediate in the production of drug candidates, allowing for efficient and scalable synthesis processes.In addition to pharmaceuticals, 3-AMINO-3-(3,4-DIFLUORO-PHENYL)-PROPANOIC ACID is also utilized in agrochemical synthesis. By using this compound as a starting material, chemists can design and develop new crop protection agents or herbicides with improved efficacy and reduced environmental impact. The incorporation of 3-AMINO-3-(3,4-DIFLUORO-PHENYL)-PROPANOIC ACID into the chemical structure of these agricultural products can lead to enhanced performance and increased selectivity against target pests or weeds.Overall, the versatility and utility of 3-AMINO-3-(3,4-DIFLUORO-PHENYL)-PROPANOIC ACID make it an indispensable tool in modern chemical synthesis, enabling the creation of innovative and potentially life-saving molecules in the fields of medicine and agriculture.