
Catalog Number	AR01PE44
Chemical Name	9H-Purin-2-amine, 6-[[4-[(2-propyn-1-yloxy)methyl]phenyl]methoxy]-
CAS Number	680622-71-3
Molecular Formula	C16H15N5O2
Molecular Weight	309.3226
MDL Number	MFCD30146126
SMILES	C#CCOCc1ccc(cc1)COc1nc(N)nc2c1[nH]cn2

6-[[4-[(2-Propyn-1-yloxy)methyl]phenyl]methoxy]-9H-purin-2-amine, also known as $name$, is a versatile compound widely used in chemical synthesis. Its unique structure makes it an important building block in organic chemistry, particularly in the synthesis of various pharmaceuticals, agrochemicals, and materials.This compound serves as a key intermediate in the preparation of novel purine derivatives with promising biological activities. Due to its reactive propynyl functional group, $name$ can be efficiently incorporated into target molecules through cross-coupling reactions, such as Sonogashira coupling, to introduce further diversity and functionality.Moreover, the phenylmethyl and methoxy moieties in $name$ provide additional opportunities for structural modifications to tailor the properties of the final products. These substituents can be selectively manipulated to fine-tune the pharmacological or physicochemical properties of the synthesized compounds.In summary, the application of 6-[[4-[(2-Propyn-1-yloxy)methyl]phenyl]methoxy]-9H-purin-2-amine in chemical synthesis offers a strategic approach for the efficient construction of complex organic molecules with diverse functionalities and potential applications in drug discovery and material science.