
Catalog Number	AR005PSH
Chemical Name	Benzenebutanoic acid, b-amino-4-chloro-, (betaR)-
CAS Number	678969-21-6
Molecular Formula	C10H12ClNO2
Molecular Weight	213.6608
MDL Number	MFCD08669374
SMILES	N[C@H](Cc1ccc(cc1)Cl)CC(=O)O

Benzenebutanoic acid, b-amino-4-chloro-, (betaR)- is a valuable chemical compound utilized extensively in chemical synthesis. This compound plays a crucial role as a chiral building block in the preparation of various pharmaceutical intermediates and fine chemicals. Its unique structure and reactivity make it a versatile starting material for the synthesis of complex organic molecules with specific stereochemistry. In organic synthesis, this compound acts as a key intermediate in the construction of biologically active compounds, such as amino acids, peptides, and pharmaceutical drugs. Its strategic incorporation into synthetic routes enables the precise control of chirality, leading to the production of enantiomerically pure compounds with high yield and selectivity. Additionally, Benzenebutanoic acid, b-amino-4-chloro-, (betaR)- serves as a valuable tool in the development of innovative synthetic methodologies, paving the way for the discovery of novel molecules with potential applications in drug discovery, material science, and other fields.