
Catalog Number	AR00FAXH
Chemical Name	5-NITRO INDAZOLE CARBOXALDEHYDE
CAS Number	677702-36-2
Molecular Formula	C8H5N3O3
Molecular Weight	191.1436
MDL Number	MFCD07781436
SMILES	O=Cc1n[nH]c2c1cc(cc2)[N+](=O)[O-]

5-Nitro-1H-indazole-3-carbaldehyde is a versatile compound that finds widespread application in chemical synthesis processes. It serves as a key building block in the creation of various complex organic molecules and exhibits valuable reactivity in a range of reactions.Its utility in chemical synthesis lies in its ability to serve as a precursor for the synthesis of a variety of pharmacologically active compounds, dyes, and other functional materials. Specifically, 5-Nitro-1H-indazole-3-carbaldehyde is often utilized as a starting material in the development of new drugs, agrochemicals, and fine chemicals due to its synthetic potential and structural versatility.In organic synthesis, this compound can undergo various transformations such as reduction, condensation, and substitution reactions to introduce different functional groups at specific positions on the indazole ring. This enables chemists to access a diverse array of derivatives with unique properties and characteristics, making it a valuable tool in the synthesis of complex molecular structures.Overall, the application of 5-Nitro-1H-indazole-3-carbaldehyde in chemical synthesis allows for the efficient construction of diverse organic molecules with potential applications in pharmaceuticals, materials science, and other advanced fields of research.