
Catalog Number	AR0064YA
Chemical Name	l-prolyl-l-glutamic acid
CAS Number	67644-00-2
Molecular Formula	C10H16N2O5
Molecular Weight	244.2444
MDL Number	MFCD00037872
SMILES	OC(=O)CC[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1

L-Prolyl-L-glutamic acid, also known as Pro-Glu, is a dipeptide commonly used in chemical synthesis due to its versatile applications. This compound is valued for its ability to serve as a building block in the creation of various peptides and proteins. In chemical synthesis, L-Prolyl-L-glutamic acid acts as a key component in the formation of peptide bonds, playing a crucial role in linking amino acids together to form longer peptide chains. This dipeptide's unique chemical properties make it a valuable tool in designing and synthesizing specific sequences of peptides with desired structures and functions. Researchers and chemists utilize L-Prolyl-L-glutamic acid in the development of pharmaceuticals, bioconjugates, and materials that require precise control over peptide composition and functionality. Its role in chemical synthesis extends beyond peptide formation, as it can also be employed as a chiral building block in the creation of complex organic molecules. By harnessing the reactivity and specificity of L-Prolyl-L-glutamic acid, chemists can unlock a wide range of possibilities for designing and producing innovative compounds with tailored properties and applications.