
Catalog Number	AR00FC1Q
Chemical Name	7-AMINO-3-BETA-D-RIBOFURANOSYL-1H-PYRAZOLO[4,3-D]PYRIMIDINE MONOHYDRATE
CAS Number	6742-12-7
Molecular Formula	C10H13N5O4
Molecular Weight	267.2413
MDL Number	MFCD00036807
SMILES	OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)c1n[nH]c2c1ncnc2N

Formycin, a nucleoside analog, is a versatile compound widely utilized in chemical synthesis processes. It serves as a crucial building block in the creation of various nucleoside derivatives, offering chemists a valuable tool for the modification and development of nucleic acid-based materials. Formycin's unique structural composition makes it an excellent candidate for the design and synthesis of novel nucleoside analogs with diverse biological activities. Its presence in chemical reactions can lead to the formation of structurally distinct molecules with potential therapeutic applications in drug discovery and development. Formycin's role in chemical synthesis extends beyond its individual properties, demonstrating its significance in the broader landscape of nucleoside chemistry.