
Catalog Number	AR00FDKX
Chemical Name	Piperidine, 4-[4-(trifluoromethyl)phenyl]-
CAS Number	67259-63-6
Molecular Formula	C12H14F3N
Molecular Weight	229.2415
MDL Number	MFCD05189944
SMILES	FC(c1ccc(cc1)C1CCNCC1)(F)F

4-(4-(Trifluoromethyl)phenyl)piperidine is a versatile compound widely utilized in chemical synthesis due to its unique structural properties and functional groups. In organic chemistry, it serves as a valuable building block for the synthesis of various pharmaceuticals, agrochemicals, and materials.Due to the presence of the piperidine ring and the trifluoromethyl group, this compound exhibits distinct reactivity patterns that can be harnessed in synthetic routes. The piperidine ring confers conformational flexibility and biological activity to the molecules it is incorporated into, making it a valuable moiety in drug design and discovery. The trifluoromethyl group, on the other hand, is a powerful electron-withdrawing substituent that can tune the physicochemical properties and reactivity of organic compounds. Its presence enhances the lipophilicity and metabolic stability of the molecules, making them potentially more effective in various applications.In chemical synthesis, 4-(4-(Trifluoromethyl)phenyl)piperidine can act as a key intermediate in the construction of complex molecules through reactions such as nucleophilic substitutions, aromatic functionalizations, and cycloadditions. By strategically incorporating this compound into synthetic routes, chemists can access a wide range of novel compounds with diverse structures and properties for further biological evaluation or material development. Its versatility and unique combination of functional groups make it an invaluable tool in modern organic chemistry research and development.