
Catalog Number	AR00FM2G
Chemical Name	5-Bromo-3-nitrobenzene-1,2-diol
CAS Number	671779-99-0
Molecular Formula	C6H4BrNO4
Molecular Weight	234.00426
MDL Number	MFCD30291683
SMILES	Brc1cc(O)c(c(c1)[N+](=O)[O-])O

5-Bromo-3-nitro-1,2-benzenediol, also known as BNBD, is a key element in chemical synthesis due to its versatility and unique properties. This compound is widely used as a building block in the production of various organic compounds and pharmaceuticals. Specifically, BNBD is utilized as a starting material for the synthesis of dyes, pigments, and agrochemicals. Its nitro and bromo functional groups make it a valuable intermediate in the manufacturing of complex organic molecules. Additionally, BNBD serves as a crucial reagent in the preparation of specialty chemicals and advanced materials. Its ability to undergo various chemical reactions makes it an indispensable compound in the field of organic synthesis.