
Catalog Number	AR00FCBP
Chemical Name	(4'-Formyl-biphenyl-2-yl)-acetic acid
CAS Number	669713-88-6
Molecular Formula	C15H12O3
Molecular Weight	240.25398000000004
MDL Number	MFCD03426485
SMILES	O=Cc1ccc(cc1)c1ccccc1CC(=O)O

4′-Formyl[1,1′-biphenyl]-2-acetic acid, also known as $name$, is a versatile compound widely used in chemical synthesis. Its unique structure and properties make it a valuable building block for the creation of various organic molecules. In chemical synthesis, $name$ can be utilized as a key intermediate in the production of pharmaceuticals, agrochemicals, and materials. It serves as a precursor in the preparation of complex molecules with specific functionalities, aiding in the development of new drugs, advanced materials, and specialty chemicals. Additionally, $name$ can participate in diverse synthetic transformations, such as cross-coupling reactions, condensation reactions, and oxidative processes, enabling the construction of intricate molecular architectures. Its strategic incorporation in synthetic routes facilitates the efficient and selective formation of desired products, showcasing its significance in modern organic chemistry applications.