
Catalog Number	AR003NK9
Chemical Name	5-Methyl-2-nitrobenzyl chloride
CAS Number	66424-91-7
Molecular Formula	C8H8ClNO2
Molecular Weight	185.6076
MDL Number	MFCD00007369
SMILES	ClCc1cc(C)ccc1[N+](=O)[O-]

2-(Chloromethyl)-4-methyl-1-nitrobenzene is a versatile compound widely used in chemical synthesis for its reactivity and functional group compatibility. This compound serves as a valuable building block for the synthesis of various organic compounds, including pharmaceuticals, agrochemicals, and specialty chemicals. Its chloromethyl and nitro functional groups make it a key intermediate in the preparation of complex molecules through multistep organic reactions. Specifically, 2-(Chloromethyl)-4-methyl-1-nitrobenzene is utilized in the formation of carbon-carbon and carbon-nitrogen bonds, as well as in the introduction of reactive sites for further modifications. Its unique chemical properties and compatibility with a wide range of reagents and catalysts make it an essential component in the toolbox of synthetic chemists aiming to create novel and valuable compounds.