
Catalog Number	AR01JENQ
Chemical Name	3-Cyclohexene-1-carboxaldehyde, 1-methyl-4-(4-methylpentyl)-
CAS Number	66327-54-6
Molecular Formula	C14H24O
Molecular Weight	208.3398
MDL Number	MFCD01735053
SMILES	O=CC1(C)CCC(=CC1)CCCC(C)C

3-Cyclohexene-1-carboxaldehyde, 1-methyl-4-(4-methylpentyl)- is a highly versatile compound used in chemical synthesis for various applications. This compound serves as a key building block in the creation of complex organic compounds through various reactions including cycloadditions, oxidation, and reduction processes. Additionally, its unique structure enables it to participate in diverse reactions that lead to the formation of valuable intermediates used in the pharmaceutical and fragrance industries. Furthermore, 3-Cyclohexene-1-carboxaldehyde, 1-methyl-4-(4-methylpentyl)- has proven to be an essential component in the development of novel materials and as a precursor for the synthesis of specialized organic molecules with specific properties. Its presence in chemical synthesis processes highlights its importance in the generation of innovative and impactful compounds with wide-ranging applications.