
Catalog Number	AR003E8Z
Chemical Name	1,3-DIIMINOBENZ[F]ISOINDOLINE
CAS Number	65558-69-2
Molecular Formula	C12H9N3
Molecular Weight	195.2200
MDL Number	MFCD00059067
SMILES	N=C1N=C(c2c1cc1ccccc1c2)N

1H-Benzo[f]isoindole-1,3(2H)-diimine is a versatile compound widely utilized in chemical synthesis for its unique structural features and reactivity. With its distinct nitrogen-containing fused ring system, this compound serves as a valuable building block in the development of various organic molecules. Its applications span across different fields of chemistry, including pharmaceuticals, materials science, and organic synthesis.In chemical synthesis, 1H-Benzo[f]isoindole-1,3(2H)-diimine plays a crucial role as a key intermediate for constructing complex organic molecules. It can undergo a range of synthetic transformations, such as functional group manipulations, cross-coupling reactions, and cyclization reactions, leading to the efficient formation of diverse chemical structures.One of the significant applications of 1H-Benzo[f]isoindole-1,3(2H)-diimine is its use in the synthesis of biologically active compounds, pharmaceutical intermediates, and natural products. By incorporating this compound into synthetic routes, chemists can access novel molecular scaffolds that exhibit unique biological properties or pharmacological activities.Furthermore, 1H-Benzo[f]isoindole-1,3(2H)-diimine acts as a valuable precursor for the development of advanced materials with tailored properties. Its versatile reactivity allows for the modification of its structure to impart specific functionalities, making it a desirable building block for the design of new materials with applications in electronics, optics, and catalysis.Overall, the versatility and reactivity of 1H-Benzo[f]isoindole-1,3(2H)-diimine make it an indispensable tool in chemical synthesis, enabling the efficient construction of complex organic molecules with diverse applications across various scientific disciplines.