
Catalog Number	AR00EKK5
Chemical Name	5-(Aminomethyl)-2-(N-Boc)aminopyridine
CAS Number	654679-12-6
Molecular Formula	C12H19N3O2
Molecular Weight	237.2982
MDL Number	MFCD07781132
SMILES	NCc1ccc(nc1)CNC(=O)OC(C)(C)C

The tert-Butyl ((5-(aminomethyl)pyridin-2-yl)methyl)carbamate, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. It is commonly utilized as a protecting group for amines in organic synthesis. This compound provides a method for temporary masking of amine functionalities, allowing selective manipulations of other reactive groups without interference. Additionally, $name$ can be employed as a precursor in the synthesis of various complex organic molecules, including pharmaceuticals, agrochemicals, and materials. Its unique structure and reactivity make it an essential tool for chemists in designing and constructing intricate molecular architectures with precision and efficiency.