
Catalog Number	AR00ELH2
Chemical Name	PRIMULIC ACID 1
CAS Number	65312-86-9
Molecular Formula	C54H88O23
Molecular Weight	1105.2627
MDL Number	MFCD08460274
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O[C@@H]2O[C@H](CO)[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O)O)O)C(=O)O)O[C@H]2CC[C@]3(C(C2(C)C)CC[C@@]2(C3CC[C@]34[C@@]2(C)C[C@H]([C@@]2(C4CC(C)(C)CC2)CO3)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O

Primulasaponin, a versatile compound extracted from the Primula species, plays a crucial role in chemical synthesis due to its unique properties. This natural compound serves as a valuable starting material for the creation of various synthetic chemicals and pharmaceuticals. Primulasaponin features a complex structure that can be modified and functionalized through chemical reactions, making it an ideal building block for organic synthesis. In the field of medicinal chemistry, Primulasaponin is utilized for the development of novel drug candidates with potential therapeutic benefits. Its structural diversity and reactivity make it a valuable resource for the synthesis of bioactive compounds targeting specific molecular pathways. Additionally, Primulasaponin can serve as a precursor for the construction of complex natural products, enabling researchers to access challenging chemical motifs efficiently. In summary, the application of Primulasaponin in chemical synthesis offers a promising avenue for the design and production of innovative molecules with diverse applications in pharmaceuticals, agrochemicals, and materials science.